C22H27NO6 — CID 139902641
[4-[3-(oxan-2-yloxy)propyl]-3-pyridinyl] 2,6-dimethoxybenzoate (PubChem CID 139902641) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [4-[3-(oxan-2-yloxy)propyl]-3-pyridinyl] 2,6-dimethoxybenzoate.
| Compound Name | [4-[3-(oxan-2-yloxy)propyl]-3-pyridinyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 139902641 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [4-[3-(oxan-2-yloxy)propyl]-3-pyridinyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)Oc1cnccc1CCCOC1CCCCO1 |
| InChI | InChI=1S/C22H27NO6/c1-25-17-8-5-9-18(26-2)21(17)22(24)29-19-15-23-12-11-16(19)7-6-14-28-20-10-3-4-13-27-20/h5,8-9,11-12,15,20H,3-4,6-7,10,13-14H2,1-2H3 |
| InChIKey | ZYAGVKRZFKCXQN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|