C12H6F6N2O3S2 — CID 139907634
2-sulfanylidene-6-(trifluoromethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]-1H-pyrimidin-4-one (PubChem CID 139907634) has the molecular formula C12H6F6N2O3S2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 2-sulfanylidene-6-(trifluoromethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]-1H-pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-6-(trifluoromethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 139907634 |
| Molecular Formula | C12H6F6N2O3S2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2-sulfanylidene-6-(trifluoromethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]-1H-pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)F)[nH]c(=S)n1-c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H6F6N2O3S2/c13-11(14,15)8-5-9(21)20(10(24)19-8)6-1-3-7(4-2-6)25(22,23)12(16,17)18/h1-5H,(H,19,24) |
| InChIKey | MREACOFQGSZPPD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|