C13H8N2O4 — CID 139908605
[(2,3-dioxoaziridin-1-yl)amino] naphthalene-2-carboxylate (PubChem CID 139908605) has the molecular formula C13H8N2O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is [(2,3-dioxoaziridin-1-yl)amino] naphthalene-2-carboxylate.
| Compound Name | [(2,3-dioxoaziridin-1-yl)amino] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139908605 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | [(2,3-dioxoaziridin-1-yl)amino] naphthalene-2-carboxylate |
| SMILES | O=C(ONn1c(=O)c1=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H8N2O4/c16-11-12(17)15(11)14-19-13(18)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,14H |
| InChIKey | SPTBYKNEOAZUJE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|