C15H14Cl2N4O — CID 139913480
1-(N'-chlorocarbamimidoyl)-3-[(3-chlorophenyl)-phenylmethyl]urea (PubChem CID 139913480) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 1-(N'-chlorocarbamimidoyl)-3-[(3-chlorophenyl)-phenylmethyl]urea.
| Compound Name | 1-(N'-chlorocarbamimidoyl)-3-[(3-chlorophenyl)-phenylmethyl]urea |
|---|---|
| PubChem CID | 139913480 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(N'-chlorocarbamimidoyl)-3-[(3-chlorophenyl)-phenylmethyl]urea |
| SMILES | NC(=NCl)NC(=O)NC(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N4O/c16-12-8-4-7-11(9-12)13(10-5-2-1-3-6-10)19-15(22)20-14(18)21-17/h1-9,13H,(H4,18,19,20,21,22) |
| InChIKey | VSSFLKLUFQAWEQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|