C16H12ClF3N2O2 — CID 15812180
N-[[(3-chlorophenyl)-phenylmethyl]carbamoyl]-2,2,2-trifluoroacetamide (PubChem CID 15812180) has the molecular formula C16H12ClF3N2O2 and a molecular weight of 356.73 g/mol. Its IUPAC name is N-[[(3-chlorophenyl)-phenylmethyl]carbamoyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(3-chlorophenyl)-phenylmethyl]carbamoyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15812180 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[[(3-chlorophenyl)-phenylmethyl]carbamoyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC(=O)C(F)(F)F)NC(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-12-8-4-7-11(9-12)13(10-5-2-1-3-6-10)21-15(24)22-14(23)16(18,19)20/h1-9,13H,(H2,21,22,23,24) |
| InChIKey | GVYAKGYKNXOISL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |