C15H21BrO4S — CID 139914843
1-(4-bromophenyl)-3-cyclohexyl-3-hydroxypropane-1-sulfonic acid (PubChem CID 139914843) has the molecular formula C15H21BrO4S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-cyclohexyl-3-hydroxypropane-1-sulfonic acid.
| Compound Name | 1-(4-bromophenyl)-3-cyclohexyl-3-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 139914843 |
| Molecular Formula | C15H21BrO4S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-cyclohexyl-3-hydroxypropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(CC(O)C1CCCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrO4S/c16-13-8-6-12(7-9-13)15(21(18,19)20)10-14(17)11-4-2-1-3-5-11/h6-9,11,14-15,17H,1-5,10H2,(H,18,19,20) |
| InChIKey | AHQPTGPQEYRADI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|