C14H12ClN5O2 — CID 139915667
2-[2-(4-chlorophenyl)-8-oxo-7H-purin-9-yl]-N-methylacetamide (PubChem CID 139915667) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-8-oxo-7H-purin-9-yl]-N-methylacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-8-oxo-7H-purin-9-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 139915667 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-8-oxo-7H-purin-9-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(=O)[nH]c2cnc(-c3ccc(Cl)cc3)nc21 |
| InChI | InChI=1S/C14H12ClN5O2/c1-16-11(21)7-20-13-10(18-14(20)22)6-17-12(19-13)8-2-4-9(15)5-3-8/h2-6H,7H2,1H3,(H,16,21)(H,18,22) |
| InChIKey | AXOZYQUCXUQECD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |