C15H15N5O2 — CID 139915656
N-ethyl-2-(8-oxo-2-phenyl-7H-purin-9-yl)acetamide (PubChem CID 139915656) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-ethyl-2-(8-oxo-2-phenyl-7H-purin-9-yl)acetamide.
| Compound Name | N-ethyl-2-(8-oxo-2-phenyl-7H-purin-9-yl)acetamide |
|---|---|
| PubChem CID | 139915656 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-ethyl-2-(8-oxo-2-phenyl-7H-purin-9-yl)acetamide |
| SMILES | CCNC(=O)Cn1c(=O)[nH]c2cnc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C15H15N5O2/c1-2-16-12(21)9-20-14-11(18-15(20)22)8-17-13(19-14)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3,(H,16,21)(H,18,22) |
| InChIKey | ZPKFMFKJRKLRDS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |