C17H13N5O — CID 141219426
9-benzyl-2-pyridin-3-yl-7H-purin-8-one (PubChem CID 141219426) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 9-benzyl-2-pyridin-3-yl-7H-purin-8-one.
| Compound Name | 9-benzyl-2-pyridin-3-yl-7H-purin-8-one |
|---|---|
| PubChem CID | 141219426 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 9-benzyl-2-pyridin-3-yl-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-c3cccnc3)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C17H13N5O/c23-17-20-14-10-19-15(13-7-4-8-18-9-13)21-16(14)22(17)11-12-5-2-1-3-6-12/h1-10H,11H2,(H,20,23) |
| InChIKey | SXLDCLNIQRPQKG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |