C18H14N6O2 — CID 174765679
N-(9-benzyl-8-oxo-2-pyridin-3-yl-7H-purin-6-yl)formamide (PubChem CID 174765679) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is N-(9-benzyl-8-oxo-2-pyridin-3-yl-7H-purin-6-yl)formamide.
| Compound Name | N-(9-benzyl-8-oxo-2-pyridin-3-yl-7H-purin-6-yl)formamide |
|---|---|
| PubChem CID | 174765679 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-(9-benzyl-8-oxo-2-pyridin-3-yl-7H-purin-6-yl)formamide |
| SMILES | O=CNc1nc(-c2cccnc2)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C18H14N6O2/c25-11-20-16-14-17(23-15(22-16)13-7-4-8-19-9-13)24(18(26)21-14)10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H,21,26)(H,20,22,23,25) |
| InChIKey | VHGIPYRWLIEXLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|