C21H20N6O4 — CID 174765922
N-[2-[2-(hydroxymethyl)anilino]-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide (PubChem CID 174765922) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[2-[2-(hydroxymethyl)anilino]-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide.
| Compound Name | N-[2-[2-(hydroxymethyl)anilino]-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide |
|---|---|
| PubChem CID | 174765922 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[2-[2-(hydroxymethyl)anilino]-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide |
| SMILES | COc1ccccc1Cn1c(=O)[nH]c2c(NC=O)nc(Nc3ccccc3CO)nc21 |
| InChI | InChI=1S/C21H20N6O4/c1-31-16-9-5-3-6-13(16)10-27-19-17(24-21(27)30)18(22-12-29)25-20(26-19)23-15-8-4-2-7-14(15)11-28/h2-9,12,28H,10-11H2,1H3,(H,24,30)(H2,22,23,25,26,29) |
| InChIKey | WTRZOFIRONQHRR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|