C20H18N6O3 — CID 174765912
N-[2-(3-hydroxyanilino)-9-[(2-methoxyphenyl)methyl]purin-6-yl]formamide (PubChem CID 174765912) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[2-(3-hydroxyanilino)-9-[(2-methoxyphenyl)methyl]purin-6-yl]formamide.
| Compound Name | N-[2-(3-hydroxyanilino)-9-[(2-methoxyphenyl)methyl]purin-6-yl]formamide |
|---|---|
| PubChem CID | 174765912 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-(3-hydroxyanilino)-9-[(2-methoxyphenyl)methyl]purin-6-yl]formamide |
| SMILES | COc1ccccc1Cn1cnc2c(NC=O)nc(Nc3cccc(O)c3)nc21 |
| InChI | InChI=1S/C20H18N6O3/c1-29-16-8-3-2-5-13(16)10-26-11-21-17-18(22-12-27)24-20(25-19(17)26)23-14-6-4-7-15(28)9-14/h2-9,11-12,28H,10H2,1H3,(H2,22,23,24,25,27) |
| InChIKey | RZAUCMHNSHPIDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|