C16H18N6O4 — CID 174885396
N-[2-(2-hydroxyethylamino)-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide (PubChem CID 174885396) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[2-(2-hydroxyethylamino)-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide.
| Compound Name | N-[2-(2-hydroxyethylamino)-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide |
|---|---|
| PubChem CID | 174885396 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-(2-hydroxyethylamino)-9-[(2-methoxyphenyl)methyl]-8-oxo-7H-purin-6-yl]formamide |
| SMILES | COc1ccccc1Cn1c(=O)[nH]c2c(NC=O)nc(NCCO)nc21 |
| InChI | InChI=1S/C16H18N6O4/c1-26-11-5-3-2-4-10(11)8-22-14-12(19-16(22)25)13(18-9-24)20-15(21-14)17-6-7-23/h2-5,9,23H,6-8H2,1H3,(H,19,25)(H2,17,18,20,21,24) |
| InChIKey | DJNSVYSUSMTKQO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|