C42H37FN2O3S — CID 139917083
ethyl 1-cyclopropyl-7-fluoro-9-methyl-4-oxo-8-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinolizine-3-carboxylate (PubChem CID 139917083) has the molecular formula C42H37FN2O3S and a molecular weight of 668.83 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-7-fluoro-9-methyl-4-oxo-8-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinolizine-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-7-fluoro-9-methyl-4-oxo-8-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 139917083 |
| Molecular Formula | C42H37FN2O3S |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | ethyl 1-cyclopropyl-7-fluoro-9-methyl-4-oxo-8-(6-trityl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CC2)c2c(C)c(-c3cc4c(s3)CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC4)c(F)cn2c1=O |
| InChI | InChI=1S/C42H37FN2O3S/c1-3-48-41(47)34-24-33(28-19-20-28)39-27(2)38(35(43)25-45(39)40(34)46)36-23-29-21-22-44(26-37(29)49-36)42(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-18,23-25,28H,3,19-22,26H2,1-2H3 |
| InChIKey | NQEWMVJNXJIBMZ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|