C43H41N3O3S — CID 139917049
ethyl 1-cyclopropyl-9-methyl-8-[5-methyl-7-(tritylamino)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-4-oxoquinolizine-3-carboxylate (PubChem CID 139917049) has the molecular formula C43H41N3O3S and a molecular weight of 679.89 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-9-methyl-8-[5-methyl-7-(tritylamino)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-4-oxoquinolizine-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-9-methyl-8-[5-methyl-7-(tritylamino)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-4-oxoquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 139917049 |
| Molecular Formula | C43H41N3O3S |
| Molecular Weight | 679.89 g/mol |
| Exact Mass | 679.29 |
| IUPAC Name | ethyl 1-cyclopropyl-9-methyl-8-[5-methyl-7-(tritylamino)-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]-4-oxoquinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CC2)c2c(C)c(-c3cc4c(s3)C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)CN(C)C4)ccn2c1=O |
| InChI | InChI=1S/C43H41N3O3S/c1-4-49-42(48)36-25-35(29-20-21-29)39-28(2)34(22-23-46(39)41(36)47)38-24-30-26-45(3)27-37(40(30)50-38)44-43(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-19,22-25,29,37,44H,4,20-21,26-27H2,1-3H3 |
| InChIKey | BHMIEMGPPDPEPN-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.89 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|