C21H12F8N2O3 — CID 139917700
methyl N-[2,4-bis[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanimidate (PubChem CID 139917700) has the molecular formula C21H12F8N2O3 and a molecular weight of 492.32 g/mol. Its IUPAC name is methyl N-[2,4-bis[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanimidate.
| Compound Name | methyl N-[2,4-bis[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanimidate |
|---|---|
| PubChem CID | 139917700 |
| Molecular Formula | C21H12F8N2O3 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | methyl N-[2,4-bis[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]methanimidate |
| SMILES | CO/C=N/c1c(Oc2ccc(F)c(C(F)(F)F)c2)ccnc1Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H12F8N2O3/c1-32-10-31-18-17(33-11-2-4-15(22)13(8-11)20(24,25)26)6-7-30-19(18)34-12-3-5-16(23)14(9-12)21(27,28)29/h2-10H,1H3/b31-10+ |
| InChIKey | ADRLKWMTTAYWGI-VNTWQREPSA-N |
| XLogP | 7.29 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|