About tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate
tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 139918311) has the molecular formula C13H19ClO2
and a molecular weight of 242.75 g/mol. Its IUPAC name is tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate.
Analyze tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate (CID 139918311) is tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate is CCC1=C(C(=O)OC(C)(C)C)CCC(Cl)=C1.
What is the InChIKey of tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is ABFFWEUWDYBKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO2/c1-5-9-8-10(14)6-7-11(9)12(15)16-13(2,3)4/h8H,5-7H2,1-4H3.
What are the key properties of tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 242.75 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 139918311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).