C31H39N3O3 — CID 139919209
benzhydryl 1-[5-acetamido-3-(1H-imidazol-2-yl)-4-methylhexyl]cyclopentane-1-carboxylate (PubChem CID 139919209) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is benzhydryl 1-[5-acetamido-3-(1H-imidazol-2-yl)-4-methylhexyl]cyclopentane-1-carboxylate.
| Compound Name | benzhydryl 1-[5-acetamido-3-(1H-imidazol-2-yl)-4-methylhexyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 139919209 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | benzhydryl 1-[5-acetamido-3-(1H-imidazol-2-yl)-4-methylhexyl]cyclopentane-1-carboxylate |
| SMILES | CC(=O)NC(C)C(C)C(CCC1(C(=O)OC(c2ccccc2)c2ccccc2)CCCC1)c1ncc[nH]1 |
| InChI | InChI=1S/C31H39N3O3/c1-22(23(2)34-24(3)35)27(29-32-20-21-33-29)16-19-31(17-10-11-18-31)30(36)37-28(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-9,12-15,20-23,27-28H,10-11,16-19H2,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | RNYZBGFGAGCPFA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |