C23H40N4O5 — CID 139919241
3-[2-(methylcarbamoyl)piperidine-1-carbonyl]-2-[2-(methylcarbamoyl)piperidin-1-yl]octanoic acid (PubChem CID 139919241) has the molecular formula C23H40N4O5 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[2-(methylcarbamoyl)piperidine-1-carbonyl]-2-[2-(methylcarbamoyl)piperidin-1-yl]octanoic acid.
| Compound Name | 3-[2-(methylcarbamoyl)piperidine-1-carbonyl]-2-[2-(methylcarbamoyl)piperidin-1-yl]octanoic acid |
|---|---|
| PubChem CID | 139919241 |
| Molecular Formula | C23H40N4O5 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 3-[2-(methylcarbamoyl)piperidine-1-carbonyl]-2-[2-(methylcarbamoyl)piperidin-1-yl]octanoic acid |
| SMILES | CCCCCC(C(=O)N1CCCCC1C(=O)NC)C(C(=O)O)N1CCCCC1C(=O)NC |
| InChI | InChI=1S/C23H40N4O5/c1-4-5-6-11-16(22(30)27-15-10-8-13-18(27)21(29)25-3)19(23(31)32)26-14-9-7-12-17(26)20(28)24-2/h16-19H,4-15H2,1-3H3,(H,24,28)(H,25,29)(H,31,32) |
| InChIKey | KFPQADWAPMFZRZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|