C18H22BrN3O3 — CID 139919396
2-(5-bromo-3-pyridinyl)-N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]acetamide (PubChem CID 139919396) has the molecular formula C18H22BrN3O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]acetamide.
| Compound Name | 2-(5-bromo-3-pyridinyl)-N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 139919396 |
| Molecular Formula | C18H22BrN3O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)Cc2cncc(Br)c2)cc1OCCN(C)C |
| InChI | InChI=1S/C18H22BrN3O3/c1-22(2)6-7-25-17-10-15(4-5-16(17)24-3)21-18(23)9-13-8-14(19)12-20-11-13/h4-5,8,10-12H,6-7,9H2,1-3H3,(H,21,23) |
| InChIKey | WTAWXDSQTSAKAP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |