C21H19N2O8P — CID 139919946
[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-16-yl]methyl dihydrogen phosphate (PubChem CID 139919946) has the molecular formula C21H19N2O8P and a molecular weight of 458.36 g/mol. Its IUPAC name is [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-16-yl]methyl dihydrogen phosphate.
| Compound Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-16-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139919946 |
| Molecular Formula | C21H19N2O8P |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-16-yl]methyl dihydrogen phosphate |
| SMILES | CC[C@@]1(O)C(=O)OC(COP(=O)(O)O)c2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C21H19N2O8P/c1-2-21(26)13-8-15-18-12(7-11-5-3-4-6-14(11)22-18)9-23(15)19(24)17(13)16(31-20(21)25)10-30-32(27,28)29/h3-8,16,26H,2,9-10H2,1H3,(H2,27,28,29)/t16?,21-/m0/s1 |
| InChIKey | UAPCKLMMORCQKA-MRNPHLECSA-N |
| XLogP | 1.73 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|