C24H30N2O6 — CID 139920460
heptyl 2-[(3-nitro-2-phenylmethoxybenzoyl)amino]propanoate (PubChem CID 139920460) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is heptyl 2-[(3-nitro-2-phenylmethoxybenzoyl)amino]propanoate.
| Compound Name | heptyl 2-[(3-nitro-2-phenylmethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 139920460 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | heptyl 2-[(3-nitro-2-phenylmethoxybenzoyl)amino]propanoate |
| SMILES | CCCCCCCOC(=O)C(C)NC(=O)c1cccc([N+](=O)[O-])c1OCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O6/c1-3-4-5-6-10-16-31-24(28)18(2)25-23(27)20-14-11-15-21(26(29)30)22(20)32-17-19-12-8-7-9-13-19/h7-9,11-15,18H,3-6,10,16-17H2,1-2H3,(H,25,27) |
| InChIKey | WMRZUMAOIGQHBT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|