C15H15ClN4O4 — CID 139921560
ethyl (2S)-2-[(6-chloropyrimidin-4-yl)amino]-3-(4-nitrophenyl)propanoate (PubChem CID 139921560) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is ethyl (2S)-2-[(6-chloropyrimidin-4-yl)amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | ethyl (2S)-2-[(6-chloropyrimidin-4-yl)amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 139921560 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethyl (2S)-2-[(6-chloropyrimidin-4-yl)amino]-3-(4-nitrophenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)Nc1cc(Cl)ncn1 |
| InChI | InChI=1S/C15H15ClN4O4/c1-2-24-15(21)12(19-14-8-13(16)17-9-18-14)7-10-3-5-11(6-4-10)20(22)23/h3-6,8-9,12H,2,7H2,1H3,(H,17,18,19)/t12-/m0/s1 |
| InChIKey | SKSYMVWXWCZJQD-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|