C22H20F3NO4 — CID 139922040
4-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]butanoic acid (PubChem CID 139922040) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 139922040 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-[2-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]phenyl]butanoic acid |
| SMILES | COc1cc(C(F)(F)F)nc2ccc(COc3ccccc3CCCC(=O)O)cc12 |
| InChI | InChI=1S/C22H20F3NO4/c1-29-19-12-20(22(23,24)25)26-17-10-9-14(11-16(17)19)13-30-18-7-3-2-5-15(18)6-4-8-21(27)28/h2-3,5,7,9-12H,4,6,8,13H2,1H3,(H,27,28) |
| InChIKey | CLQHNQIFSZHLGY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |