C13H26O8 — CID 139923215
[4-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)ethoxy]butyl] hydrogen carbonate (PubChem CID 139923215) has the molecular formula C13H26O8 and a molecular weight of 310.34 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)ethoxy]butyl] hydrogen carbonate.
| Compound Name | [4-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)ethoxy]butyl] hydrogen carbonate |
|---|---|
| PubChem CID | 139923215 |
| Molecular Formula | C13H26O8 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [4-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)ethoxy]butyl] hydrogen carbonate |
| SMILES | COCCOCCOC(CCOCCOC)COC(=O)O |
| InChI | InChI=1S/C13H26O8/c1-16-5-7-18-4-3-12(11-21-13(14)15)20-10-9-19-8-6-17-2/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | UKRDUCULFOLIPM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|