[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate

C7H13ClO5 — CID 141068739

IUPAC[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate
SMILESCOCCOC(CCl)COC(=O)O
InChIInChI=1S/C7H13ClO5/c1-11-2-3-12-6(4-8)5-13-7(9)10/h6H,2-5H2,1H3,(H,9,10)
InChIKeyVPVAQBNDBGXUSV-UHFFFAOYSA-N
MW212.63 g/mol
LogP0.95
Rot. Bonds7

About [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate

[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate (PubChem CID 141068739) has the molecular formula C7H13ClO5 and a molecular weight of 212.63 g/mol. Its IUPAC name is [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate.

Molecular Properties

Compound Name[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate
PubChem CID141068739
Molecular FormulaC7H13ClO5
Molecular Weight212.63 g/mol
Exact Mass212.05
IUPAC Name[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate
SMILESCOCCOC(CCl)COC(=O)O
InChIInChI=1S/C7H13ClO5/c1-11-2-3-12-6(4-8)5-13-7(9)10/h6H,2-5H2,1H3,(H,9,10)
InChIKeyVPVAQBNDBGXUSV-UHFFFAOYSA-N
XLogP0.95
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.63
LogP ≤ 50.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate?
The IUPAC name of [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate (CID 141068739) is [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate.
What is the SMILES notation for [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate?
The canonical SMILES for [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate is COCCOC(CCl)COC(=O)O.
What is the InChIKey of [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate?
The InChIKey is VPVAQBNDBGXUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO5/c1-11-2-3-12-6(4-8)5-13-7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate?
[3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate has a molecular weight of 212.63 g/mol, XLogP of 0.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2-(2-methoxyethoxy)propyl] hydrogen carbonate is sourced from PubChem (CID 141068739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).