C29H56N4O16 — CID 54173836
2-[1-[3-[2-(2-aminoacetyl)oxyethoxy]-4-(2-methoxyethoxy)butoxy]-4-[2,2-bis[2-(2-aminoacetyl)oxyethoxy]ethoxy]butan-2-yl]oxyethyl 2-aminoacetate (PubChem CID 54173836) has the molecular formula C29H56N4O16 and a molecular weight of 716.78 g/mol. Its IUPAC name is 2-[1-[3-[2-(2-aminoacetyl)oxyethoxy]-4-(2-methoxyethoxy)butoxy]-4-[2,2-bis[2-(2-aminoacetyl)oxyethoxy]ethoxy]butan-2-yl]oxyethyl 2-aminoacetate.
| Compound Name | 2-[1-[3-[2-(2-aminoacetyl)oxyethoxy]-4-(2-methoxyethoxy)butoxy]-4-[2,2-bis[2-(2-aminoacetyl)oxyethoxy]ethoxy]butan-2-yl]oxyethyl 2-aminoacetate |
|---|---|
| PubChem CID | 54173836 |
| Molecular Formula | C29H56N4O16 |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | 2-[1-[3-[2-(2-aminoacetyl)oxyethoxy]-4-(2-methoxyethoxy)butoxy]-4-[2,2-bis[2-(2-aminoacetyl)oxyethoxy]ethoxy]butan-2-yl]oxyethyl 2-aminoacetate |
| SMILES | COCCOCC(CCOCC(CCOCC(OCCOC(=O)CN)OCCOC(=O)CN)OCCOC(=O)CN)OCCOC(=O)CN |
| InChI | InChI=1S/C29H56N4O16/c1-38-6-7-41-21-24(43-9-11-45-26(35)17-31)2-4-39-20-23(42-8-10-44-25(34)16-30)3-5-40-22-29(48-14-12-46-27(36)18-32)49-15-13-47-28(37)19-33/h23-24,29H,2-22,30-33H2,1H3 |
| InChIKey | OWWPJLOYBGPYDN-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 283.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|