C24H19N7O2 — CID 139923393
N-[4-(azido-cyano-phenylmethyl)phenyl]-2-(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)acetamide (PubChem CID 139923393) has the molecular formula C24H19N7O2 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[4-(azido-cyano-phenylmethyl)phenyl]-2-(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[4-(azido-cyano-phenylmethyl)phenyl]-2-(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139923393 |
| Molecular Formula | C24H19N7O2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[4-(azido-cyano-phenylmethyl)phenyl]-2-(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)acetamide |
| SMILES | N#CC(N=[N+]=[N-])(c1ccccc1)c1ccc(NC(=O)CC2CC(c3cccnc3)=NO2)cc1 |
| InChI | InChI=1S/C24H19N7O2/c25-16-24(30-31-26,18-6-2-1-3-7-18)19-8-10-20(11-9-19)28-23(32)14-21-13-22(29-33-21)17-5-4-12-27-15-17/h1-12,15,21H,13-14H2,(H,28,32) |
| InChIKey | BGUDAOXRCAAGIE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|