C23H22N2O5S — CID 139924667
methyl 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]propyl]-1H-indole-6-carboxylate (PubChem CID 139924667) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is methyl 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]propyl]-1H-indole-6-carboxylate.
| Compound Name | methyl 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]propyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 139924667 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]propyl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2cc(CCCOc3ccc(CC4SC(=O)NC4=O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H22N2O5S/c1-29-22(27)16-7-6-15-12-17(24-19(15)13-16)3-2-10-30-18-8-4-14(5-9-18)11-20-21(26)25-23(28)31-20/h4-9,12-13,20,24H,2-3,10-11H2,1H3,(H,25,26,28) |
| InChIKey | VVUGXFMAHOULGX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|