C29H33F2N7O5 — CID 139926225
4-[[2-[5-amino-2-(4-aminophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide (PubChem CID 139926225) has the molecular formula C29H33F2N7O5 and a molecular weight of 597.62 g/mol. Its IUPAC name is 4-[[2-[5-amino-2-(4-aminophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide.
| Compound Name | 4-[[2-[5-amino-2-(4-aminophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 139926225 |
| Molecular Formula | C29H33F2N7O5 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 4-[[2-[5-amino-2-(4-aminophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-N-[2-(diethylamino)-2-oxoethyl]-2,2-difluoro-3-oxo-5-phenylpentanamide |
| SMILES | CCN(CC)C(=O)CNC(=O)C(F)(F)C(=O)C(Cc1ccccc1)NC(=O)Cn1c(-c2ccc(N)cc2)ncc(N)c1=O |
| InChI | InChI=1S/C29H33F2N7O5/c1-3-37(4-2)24(40)16-35-28(43)29(30,31)25(41)22(14-18-8-6-5-7-9-18)36-23(39)17-38-26(34-15-21(33)27(38)42)19-10-12-20(32)13-11-19/h5-13,15,22H,3-4,14,16-17,32-33H2,1-2H3,(H,35,43)(H,36,39) |
| InChIKey | JJXBFVVCFAKKSY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 182.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|