C16H17FN4O4 — CID 59601425
(3R)-3-[[2-[5-amino-2-(4-fluorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]butanoic acid (PubChem CID 59601425) has the molecular formula C16H17FN4O4 and a molecular weight of 348.33 g/mol. Its IUPAC name is (3R)-3-[[2-[5-amino-2-(4-fluorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[2-[5-amino-2-(4-fluorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 59601425 |
| Molecular Formula | C16H17FN4O4 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (3R)-3-[[2-[5-amino-2-(4-fluorophenyl)-6-oxopyrimidin-1-yl]acetyl]amino]butanoic acid |
| SMILES | C[C@H](CC(=O)O)NC(=O)Cn1c(-c2ccc(F)cc2)ncc(N)c1=O |
| InChI | InChI=1S/C16H17FN4O4/c1-9(6-14(23)24)20-13(22)8-21-15(19-7-12(18)16(21)25)10-2-4-11(17)5-3-10/h2-5,7,9H,6,8,18H2,1H3,(H,20,22)(H,23,24)/t9-/m1/s1 |
| InChIKey | JJTBNUYREYZGGN-SECBINFHSA-N |
| XLogP | 0.61 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |