C17H16Cl2O3S — CID 139927139
ethyl 2-[4-[(3,5-dichlorophenyl)methylsulfanyl]phenoxy]acetate (PubChem CID 139927139) has the molecular formula C17H16Cl2O3S and a molecular weight of 371.29 g/mol. Its IUPAC name is ethyl 2-[4-[(3,5-dichlorophenyl)methylsulfanyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(3,5-dichlorophenyl)methylsulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139927139 |
| Molecular Formula | C17H16Cl2O3S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | ethyl 2-[4-[(3,5-dichlorophenyl)methylsulfanyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(SCc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16Cl2O3S/c1-2-21-17(20)10-22-15-3-5-16(6-4-15)23-11-12-7-13(18)9-14(19)8-12/h3-9H,2,10-11H2,1H3 |
| InChIKey | RGDDRVMUILVOLF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |