C20H22N2O3 — CID 139929862
N-[bis(2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide (PubChem CID 139929862) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[bis(2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide.
| Compound Name | N-[bis(2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 139929862 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[bis(2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide |
| SMILES | O=C(NN=C(c1ccccc1O)c1ccccc1O)C1CCCCC1 |
| InChI | InChI=1S/C20H22N2O3/c23-17-12-6-4-10-15(17)19(16-11-5-7-13-18(16)24)21-22-20(25)14-8-2-1-3-9-14/h4-7,10-14,23-24H,1-3,8-9H2,(H,22,25) |
| InChIKey | PJZBACGUIXRULK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|