C22H38Cl2N4O2S — CID 139931108
N-cyclooctyl-6-[2-[ethyl(2-methoxyethyl)amino]ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine;dihydrochloride (PubChem CID 139931108) has the molecular formula C22H38Cl2N4O2S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-cyclooctyl-6-[2-[ethyl(2-methoxyethyl)amino]ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine;dihydrochloride.
| Compound Name | N-cyclooctyl-6-[2-[ethyl(2-methoxyethyl)amino]ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 139931108 |
| Molecular Formula | C22H38Cl2N4O2S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-cyclooctyl-6-[2-[ethyl(2-methoxyethyl)amino]ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine;dihydrochloride |
| SMILES | CCN(CCOC)CCOCc1cc2c(NC3CCCCCCC3)ncnc2s1.Cl.Cl |
| InChI | InChI=1S/C22H36N4O2S.2ClH/c1-3-26(11-13-27-2)12-14-28-16-19-15-20-21(23-17-24-22(20)29-19)25-18-9-7-5-4-6-8-10-18;;/h15,17-18H,3-14,16H2,1-2H3,(H,23,24,25);2*1H |
| InChIKey | SBJZTCXAJGBGBA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|