C20H27N5OS2 — CID 139931144
N-cyclooctyl-6-[2-(1,3-thiazol-2-ylamino)ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 139931144) has the molecular formula C20H27N5OS2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N-cyclooctyl-6-[2-(1,3-thiazol-2-ylamino)ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclooctyl-6-[2-(1,3-thiazol-2-ylamino)ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 139931144 |
| Molecular Formula | C20H27N5OS2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-cyclooctyl-6-[2-(1,3-thiazol-2-ylamino)ethoxymethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1csc(NCCOCc2cc3c(NC4CCCCCCC4)ncnc3s2)n1 |
| InChI | InChI=1S/C20H27N5OS2/c1-2-4-6-15(7-5-3-1)25-18-17-12-16(28-19(17)24-14-23-18)13-26-10-8-21-20-22-9-11-27-20/h9,11-12,14-15H,1-8,10,13H2,(H,21,22)(H,23,24,25) |
| InChIKey | PBTRYZOKITVJOU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|