C17H17NO3S — CID 139933048
6-hydroxy-N-(methoxymethyl)-5,6-dihydrobenzo[b][1]benzothiepine-2-carboxamide (PubChem CID 139933048) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 6-hydroxy-N-(methoxymethyl)-5,6-dihydrobenzo[b][1]benzothiepine-2-carboxamide.
| Compound Name | 6-hydroxy-N-(methoxymethyl)-5,6-dihydrobenzo[b][1]benzothiepine-2-carboxamide |
|---|---|
| PubChem CID | 139933048 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6-hydroxy-N-(methoxymethyl)-5,6-dihydrobenzo[b][1]benzothiepine-2-carboxamide |
| SMILES | COCNC(=O)c1ccc2c(c1)Sc1ccccc1C(O)C2 |
| InChI | InChI=1S/C17H17NO3S/c1-21-10-18-17(20)12-7-6-11-8-14(19)13-4-2-3-5-15(13)22-16(11)9-12/h2-7,9,14,19H,8,10H2,1H3,(H,18,20) |
| InChIKey | DHCOIPBOBUXFAQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|