C19H22N6O4 — CID 139933079
(2S,3S,4R,5R)-3-amino-5-[6-[(2,5-dimethylphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 139933079) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-amino-5-[6-[(2,5-dimethylphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3-amino-5-[6-[(2,5-dimethylphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 139933079 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2S,3S,4R,5R)-3-amino-5-[6-[(2,5-dimethylphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | Cc1ccc(C)c(CNc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)O)[C@@H](N)[C@H]2O)c1 |
| InChI | InChI=1S/C19H22N6O4/c1-9-3-4-10(2)11(5-9)6-21-16-13-17(23-7-22-16)25(8-24-13)18-14(26)12(20)15(29-18)19(27)28/h3-5,7-8,12,14-15,18,26H,6,20H2,1-2H3,(H,27,28)(H,21,22,23)/t12-,14+,15-,18+/m0/s1 |
| InChIKey | CLNUWEHVXXRNRO-WLLUSJSYSA-N |
| XLogP | 0.73 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |