C25H24ClN7O6 — CID 174454365
carbamoyl 3-amino-5-[6-[(5-chloro-2-phenylmethoxyphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylate (PubChem CID 174454365) has the molecular formula C25H24ClN7O6 and a molecular weight of 553.96 g/mol. Its IUPAC name is carbamoyl 3-amino-5-[6-[(5-chloro-2-phenylmethoxyphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylate.
| Compound Name | carbamoyl 3-amino-5-[6-[(5-chloro-2-phenylmethoxyphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylate |
|---|---|
| PubChem CID | 174454365 |
| Molecular Formula | C25H24ClN7O6 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | carbamoyl 3-amino-5-[6-[(5-chloro-2-phenylmethoxyphenyl)methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylate |
| SMILES | NC(=O)OC(=O)C1OC(n2cnc3c(NCc4cc(Cl)ccc4OCc4ccccc4)ncnc32)C(O)C1N |
| InChI | InChI=1S/C25H24ClN7O6/c26-15-6-7-16(37-10-13-4-2-1-3-5-13)14(8-15)9-29-21-18-22(31-11-30-21)33(12-32-18)23-19(34)17(27)20(38-23)24(35)39-25(28)36/h1-8,11-12,17,19-20,23,34H,9-10,27H2,(H2,28,36)(H,29,30,31) |
| InChIKey | XNNCVGNXQQHVQS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 189.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|