C22H22ClN9O6 — CID 22662054
5-[6-[[2-[2-(azetidin-1-yl)-2-oxoethoxy]-5-chlorophenyl]methylamino]purin-9-yl]-3-azido-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 22662054) has the molecular formula C22H22ClN9O6 and a molecular weight of 543.93 g/mol. Its IUPAC name is 5-[6-[[2-[2-(azetidin-1-yl)-2-oxoethoxy]-5-chlorophenyl]methylamino]purin-9-yl]-3-azido-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | 5-[6-[[2-[2-(azetidin-1-yl)-2-oxoethoxy]-5-chlorophenyl]methylamino]purin-9-yl]-3-azido-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 22662054 |
| Molecular Formula | C22H22ClN9O6 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 5-[6-[[2-[2-(azetidin-1-yl)-2-oxoethoxy]-5-chlorophenyl]methylamino]purin-9-yl]-3-azido-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NC1C(C(=O)O)OC(n2cnc3c(NCc4cc(Cl)ccc4OCC(=O)N4CCC4)ncnc32)C1O |
| InChI | InChI=1S/C22H22ClN9O6/c23-12-2-3-13(37-8-14(33)31-4-1-5-31)11(6-12)7-25-19-16-20(27-9-26-19)32(10-28-16)21-17(34)15(29-30-24)18(38-21)22(35)36/h2-3,6,9-10,15,17-18,21,34H,1,4-5,7-8H2,(H,35,36)(H,25,26,27) |
| InChIKey | VWPJRDUVVCBORS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 200.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|