C24H28ClN9O4 — CID 91416923
(2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(cyclopentylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide (PubChem CID 91416923) has the molecular formula C24H28ClN9O4 and a molecular weight of 542.00 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(cyclopentylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(cyclopentylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 91416923 |
| Molecular Formula | C24H28ClN9O4 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(cyclopentylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cc(Cl)ccc4OCC4CCCC4)ncnc32)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C24H28ClN9O4/c1-27-23(36)20-17(32-33-26)19(35)24(38-20)34-12-31-18-21(29-11-30-22(18)34)28-9-14-8-15(25)6-7-16(14)37-10-13-4-2-3-5-13/h6-8,11-13,17,19-20,24,35H,2-5,9-10H2,1H3,(H,27,36)(H,28,29,30)/t17-,19+,20-,24+/m0/s1 |
| InChIKey | XNSBAQUBGMVJIC-QLBZUPSYSA-N |
| XLogP | 3.34 |
| TPSA | 172.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|