C24H25ClN10O5 — CID 91208682
3-azido-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide (PubChem CID 91208682) has the molecular formula C24H25ClN10O5 and a molecular weight of 568.98 g/mol. Its IUPAC name is 3-azido-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | 3-azido-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 91208682 |
| Molecular Formula | C24H25ClN10O5 |
| Molecular Weight | 568.98 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 3-azido-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)C1OC(n2cnc3c(NCc4cc(Cl)ccc4OCc4c(C)noc4C)ncnc32)C(O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C24H25ClN10O5/c1-11-15(12(2)40-33-11)8-38-16-5-4-14(25)6-13(16)7-28-21-18-22(30-9-29-21)35(10-31-18)24-19(36)17(32-34-26)20(39-24)23(37)27-3/h4-6,9-10,17,19-20,24,36H,7-8H2,1-3H3,(H,27,37)(H,28,29,30) |
| InChIKey | LSFUSOASNPIGHU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 198.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.98 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|