C29H35ClN10O6 — CID 22661841
3-azido-5-[6-[[5-chloro-2-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 22661841) has the molecular formula C29H35ClN10O6 and a molecular weight of 655.12 g/mol. Its IUPAC name is 3-azido-5-[6-[[5-chloro-2-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | 3-azido-5-[6-[[5-chloro-2-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 22661841 |
| Molecular Formula | C29H35ClN10O6 |
| Molecular Weight | 655.12 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 3-azido-5-[6-[[5-chloro-2-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NC1C(C(=O)O)OC(n2cnc3c(NCc4cc(Cl)ccc4OCC(=O)N4CCN(C5CCCCC5)CC4)ncnc32)C1O |
| InChI | InChI=1S/C29H35ClN10O6/c30-18-6-7-20(45-14-21(41)39-10-8-38(9-11-39)19-4-2-1-3-5-19)17(12-18)13-32-26-23-27(34-15-33-26)40(16-35-23)28-24(42)22(36-37-31)25(46-28)29(43)44/h6-7,12,15-16,19,22,24-25,28,42H,1-5,8-11,13-14H2,(H,43,44)(H,32,33,34) |
| InChIKey | LNVJHGYBKKQUKP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 203.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|