C23H27ClN10O6 — CID 91391034
(2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide (PubChem CID 91391034) has the molecular formula C23H27ClN10O6 and a molecular weight of 574.99 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 91391034 |
| Molecular Formula | C23H27ClN10O6 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-(2-methoxyethylamino)-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cc(Cl)ccc4OCC(=O)NCCOC)ncnc32)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C23H27ClN10O6/c1-26-22(37)19-16(32-33-25)18(36)23(40-19)34-11-31-17-20(29-10-30-21(17)34)28-8-12-7-13(24)3-4-14(12)39-9-15(35)27-5-6-38-2/h3-4,7,10-11,16,18-19,23,36H,5-6,8-9H2,1-2H3,(H,26,37)(H,27,35)(H,28,29,30)/t16-,18+,19-,23+/m0/s1 |
| InChIKey | CIQIUTWZQTZWEE-QYUDBREXSA-N |
| XLogP | 0.92 |
| TPSA | 210.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|