C27H28ClN9O6 — CID 91519420
(2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide (PubChem CID 91519420) has the molecular formula C27H28ClN9O6 and a molecular weight of 610.03 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 91519420 |
| Molecular Formula | C27H28ClN9O6 |
| Molecular Weight | 610.03 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[(2,5-dimethoxyphenyl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cc(Cl)ccc4OCc4cc(OC)ccc4OC)ncnc32)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C27H28ClN9O6/c1-30-26(39)23-20(35-36-29)22(38)27(43-23)37-13-34-21-24(32-12-33-25(21)37)31-10-14-8-16(28)4-6-19(14)42-11-15-9-17(40-2)5-7-18(15)41-3/h4-9,12-13,20,22-23,27,38H,10-11H2,1-3H3,(H,30,39)(H,31,32,33)/t20-,22+,23-,27+/m0/s1 |
| InChIKey | OJWARRCRWLATTG-ONLLFZDPSA-N |
| XLogP | 3.37 |
| TPSA | 190.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.03 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|