C23H22ClN9O4S — CID 90707530
(2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide (PubChem CID 90707530) has the molecular formula C23H22ClN9O4S and a molecular weight of 556.01 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 90707530 |
| Molecular Formula | C23H22ClN9O4S |
| Molecular Weight | 556.01 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methylamino]purin-9-yl]-4-hydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cc(Cl)ccc4OCc4cccs4)ncnc32)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C23H22ClN9O4S/c1-26-22(35)19-16(31-32-25)18(34)23(37-19)33-11-30-17-20(28-10-29-21(17)33)27-8-12-7-13(24)4-5-15(12)36-9-14-3-2-6-38-14/h2-7,10-11,16,18-19,23,34H,8-9H2,1H3,(H,26,35)(H,27,28,29)/t16-,18+,19-,23+/m0/s1 |
| InChIKey | IFQOHODAHHDDMA-QYUDBREXSA-N |
| XLogP | 3.42 |
| TPSA | 172.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|