C26H31ClN10O6 — CID 23523404
(2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 23523404) has the molecular formula C26H31ClN10O6 and a molecular weight of 615.05 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 23523404 |
| Molecular Formula | C26H31ClN10O6 |
| Molecular Weight | 615.05 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | (2S,3S,4R,5R)-3-azido-5-[6-[[5-chloro-2-[2-[4-(dimethylamino)piperidin-1-yl]-2-oxoethoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | CN(C)C1CCN(C(=O)COc2ccc(Cl)cc2CNc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)O)[C@@H](N=[N+]=[N-])[C@H]2O)CC1 |
| InChI | InChI=1S/C26H31ClN10O6/c1-35(2)16-5-7-36(8-6-16)18(38)11-42-17-4-3-15(27)9-14(17)10-29-23-20-24(31-12-30-23)37(13-32-20)25-21(39)19(33-34-28)22(43-25)26(40)41/h3-4,9,12-13,16,19,21-22,25,39H,5-8,10-11H2,1-2H3,(H,40,41)(H,29,30,31)/t19-,21+,22-,25+/m0/s1 |
| InChIKey | SEWOVKZVCBOWSV-XIXAVDCQSA-N |
| XLogP | 2.05 |
| TPSA | 203.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.05 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|