C23H24ClN7O6 — CID 23523351
(2S,3S,4R,5R)-3-amino-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 23523351) has the molecular formula C23H24ClN7O6 and a molecular weight of 529.94 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-amino-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3-amino-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 23523351 |
| Molecular Formula | C23H24ClN7O6 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (2S,3S,4R,5R)-3-amino-5-[6-[[5-chloro-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]purin-9-yl]-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | Cc1noc(C)c1COc1ccc(Cl)cc1CNc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)O)[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C23H24ClN7O6/c1-10-14(11(2)37-30-10)7-35-15-4-3-13(24)5-12(15)6-26-20-17-21(28-8-27-20)31(9-29-17)22-18(32)16(25)19(36-22)23(33)34/h3-5,8-9,16,18-19,22,32H,6-7,25H2,1-2H3,(H,33,34)(H,26,27,28)/t16-,18+,19-,22+/m0/s1 |
| InChIKey | ZSXLTHGBZMVJIP-YNFBMLRVSA-N |
| XLogP | 1.95 |
| TPSA | 183.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |