C26H27F9O4S2 — CID 139935554
[1-[4-(2-bicyclo[2.2.1]heptanylmethoxy)naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139935554) has the molecular formula C26H27F9O4S2 and a molecular weight of 638.61 g/mol. Its IUPAC name is [1-[4-(2-bicyclo[2.2.1]heptanylmethoxy)naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-[4-(2-bicyclo[2.2.1]heptanylmethoxy)naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139935554 |
| Molecular Formula | C26H27F9O4S2 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 638.12 |
| IUPAC Name | [1-[4-(2-bicyclo[2.2.1]heptanylmethoxy)naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OS1(c2ccc(OCC3CC4CCC3C4)c3ccccc23)CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H27F9O4S2/c27-23(28,25(31,32)33)24(29,30)26(34,35)41(36,37)39-40(11-3-4-12-40)22-10-9-21(19-5-1-2-6-20(19)22)38-15-18-14-16-7-8-17(18)13-16/h1-2,5-6,9-10,16-18H,3-4,7-8,11-15H2 |
| InChIKey | ZERMAAFRUGFJHY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|