C22H21F3O4S2 — CID 18350246
1-(6-phenylmethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate (PubChem CID 18350246) has the molecular formula C22H21F3O4S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-(6-phenylmethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-(6-phenylmethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18350246 |
| Molecular Formula | C22H21F3O4S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1-(6-phenylmethoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(COc2ccc3c([S+]4CCCC4)cccc3c2)cc1 |
| InChI | InChI=1S/C21H21OS.CHF3O3S/c1-2-7-17(8-3-1)16-22-19-11-12-20-18(15-19)9-6-10-21(20)23-13-4-5-14-23;2-1(3,4)8(5,6)7/h1-3,6-12,15H,4-5,13-14,16H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | LQQFJPYLVQBVKF-UHFFFAOYSA-M |
| XLogP | 5.24 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|