C17H21NO4 — CID 139935586
3-[2-methoxyethoxymethoxy(phenylmethoxy)methyl]pyridine (PubChem CID 139935586) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[2-methoxyethoxymethoxy(phenylmethoxy)methyl]pyridine.
| Compound Name | 3-[2-methoxyethoxymethoxy(phenylmethoxy)methyl]pyridine |
|---|---|
| PubChem CID | 139935586 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-[2-methoxyethoxymethoxy(phenylmethoxy)methyl]pyridine |
| SMILES | COCCOCOC(OCc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C17H21NO4/c1-19-10-11-20-14-22-17(16-8-5-9-18-12-16)21-13-15-6-3-2-4-7-15/h2-9,12,17H,10-11,13-14H2,1H3 |
| InChIKey | QWSDPAXVRWMBDY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|